About 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol
1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol (PubChem CID 66277916) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol |
| PubChem CID | 66277916 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol |
| SMILES | Nc1nsc(NCC2(O)CCCC2)n1 |
| InChI | InChI=1S/C8H14N4OS/c9-6-11-7(14-12-6)10-5-8(13)3-1-2-4-8/h13H,1-5H2,(H3,9,10,11,12) |
| InChIKey | KWFQTLGAPHOQSU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol?
The IUPAC name of 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol (CID 66277916) is 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol is Nc1nsc(NCC2(O)CCCC2)n1.
What is the InChIKey of 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol?
The InChIKey is KWFQTLGAPHOQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c9-6-11-7(14-12-6)10-5-8(13)3-1-2-4-8/h13H,1-5H2,(H3,9,10,11,12).
What are the key properties of 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol?
1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol has a molecular weight of 214.29 g/mol, XLogP of 0.84, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3-amino-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 66277916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).