C10H18N4S — CID 66277926
5-N-(2-methylcycloheptyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66277926) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 5-N-(2-methylcycloheptyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(2-methylcycloheptyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66277926 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-N-(2-methylcycloheptyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CC1CCCCCC1Nc1nc(N)ns1 |
| InChI | InChI=1S/C10H18N4S/c1-7-5-3-2-4-6-8(7)12-10-13-9(11)14-15-10/h7-8H,2-6H2,1H3,(H3,11,12,13,14) |
| InChIKey | XYMYWYWRMCNSOE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |