C9H18N4S — CID 66278136
5-N-(4-methylhexan-2-yl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66278136) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is 5-N-(4-methylhexan-2-yl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(4-methylhexan-2-yl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66278136 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 5-N-(4-methylhexan-2-yl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCC(C)CC(C)Nc1nc(N)ns1 |
| InChI | InChI=1S/C9H18N4S/c1-4-6(2)5-7(3)11-9-12-8(10)13-14-9/h6-7H,4-5H2,1-3H3,(H3,10,11,12,13) |
| InChIKey | ZBZSCOLVKZQIDI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |