C11H18N4S — CID 66278797
5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,2,4-thiadiazol-3-amine (PubChem CID 66278797) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 66278797 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,2,4-thiadiazol-3-amine |
| SMILES | Nc1nsc(N2CCCC3CCCCC32)n1 |
| InChI | InChI=1S/C11H18N4S/c12-10-13-11(16-14-10)15-7-3-5-8-4-1-2-6-9(8)15/h8-9H,1-7H2,(H2,12,14) |
| InChIKey | FLAXIZTXTQRRAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |