C8H14N4S — CID 66279204
5-N-cyclohexyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66279204) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 5-N-cyclohexyl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-cyclohexyl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66279204 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-N-cyclohexyl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C8H14N4S/c9-7-11-8(13-12-7)10-6-4-2-1-3-5-6/h6H,1-5H2,(H3,9,10,11,12) |
| InChIKey | BFWBNXZUFNUCFD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |