C9H14N4OS — CID 66279252
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,2,4-thiadiazol-3-amine (PubChem CID 66279252) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 66279252 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,2,4-thiadiazol-3-amine |
| SMILES | Nc1nsc(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C9H14N4OS/c10-8-11-9(15-12-8)13-4-5-14-7-3-1-2-6(7)13/h6-7H,1-5H2,(H2,10,12) |
| InChIKey | WRTOOOWRJXIRKP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |