C15H17N3O2 — CID 66279610
5-methyl-3-nitro-N-(1-phenylpropan-2-yl)pyridin-2-amine (PubChem CID 66279610) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-methyl-3-nitro-N-(1-phenylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-methyl-3-nitro-N-(1-phenylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 66279610 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-methyl-3-nitro-N-(1-phenylpropan-2-yl)pyridin-2-amine |
| SMILES | Cc1cnc(NC(C)Cc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O2/c1-11-8-14(18(19)20)15(16-10-11)17-12(2)9-13-6-4-3-5-7-13/h3-8,10,12H,9H2,1-2H3,(H,16,17) |
| InChIKey | BSUQLNNKNNKIEF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|