C6H12N4S — CID 66279643
5-N-butan-2-yl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66279643) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is 5-N-butan-2-yl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-butan-2-yl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66279643 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-N-butan-2-yl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCC(C)Nc1nc(N)ns1 |
| InChI | InChI=1S/C6H12N4S/c1-3-4(2)8-6-9-5(7)10-11-6/h4H,3H2,1-2H3,(H3,7,8,9,10) |
| InChIKey | CGFITOCNRJDVMK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |