About [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol
[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol (PubChem CID 66279901) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol |
| PubChem CID | 66279901 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol |
| SMILES | Nc1nsc(N2CCCCC2CO)n1 |
| InChI | InChI=1S/C8H14N4OS/c9-7-10-8(14-11-7)12-4-2-1-3-6(12)5-13/h6,13H,1-5H2,(H2,9,11) |
| InChIKey | YYODPMSZQBHWOJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol?
The IUPAC name of [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol (CID 66279901) is [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol.
What is the SMILES notation for [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol?
The canonical SMILES for [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol is Nc1nsc(N2CCCCC2CO)n1.
What is the InChIKey of [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol?
The InChIKey is YYODPMSZQBHWOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c9-7-10-8(14-11-7)12-4-2-1-3-6(12)5-13/h6,13H,1-5H2,(H2,9,11).
What are the key properties of [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol?
[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol has a molecular weight of 214.29 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]methanol is sourced from PubChem (CID 66279901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).