C14H22N4S — CID 66280302
5-N-[1-(1-adamantyl)ethyl]-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66280302) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is 5-N-[1-(1-adamantyl)ethyl]-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-[1-(1-adamantyl)ethyl]-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66280302 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 5-N-[1-(1-adamantyl)ethyl]-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CC(Nc1nc(N)ns1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H22N4S/c1-8(16-13-17-12(15)18-19-13)14-5-9-2-10(6-14)4-11(3-9)7-14/h8-11H,2-7H2,1H3,(H3,15,16,17,18) |
| InChIKey | NAUSYRPLBVRCAL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |