About 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol
2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol (PubChem CID 66280571) has the molecular formula C9H16N4OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol |
| PubChem CID | 66280571 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol |
| SMILES | Nc1nsc(N2CCCCC2CCO)n1 |
| InChI | InChI=1S/C9H16N4OS/c10-8-11-9(15-12-8)13-5-2-1-3-7(13)4-6-14/h7,14H,1-6H2,(H2,10,12) |
| InChIKey | XVFLRNYCTNOXBA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
The IUPAC name of 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol (CID 66280571) is 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol.
What is the SMILES notation for 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
The canonical SMILES for 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol is Nc1nsc(N2CCCCC2CCO)n1.
What is the InChIKey of 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
The InChIKey is XVFLRNYCTNOXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4OS/c10-8-11-9(15-12-8)13-5-2-1-3-7(13)4-6-14/h7,14H,1-6H2,(H2,10,12).
What are the key properties of 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol?
2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol has a molecular weight of 228.32 g/mol, XLogP of 0.86, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-amino-1,2,4-thiadiazol-5-yl)piperidin-2-yl]ethanol is sourced from PubChem (CID 66280571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).