About 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine
5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine (PubChem CID 66280784) has the molecular formula C9H16N4S
and a molecular weight of 212.32 g/mol. Its IUPAC name is 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine |
| PubChem CID | 66280784 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine |
| SMILES | Nc1nsc(N2CCCCCCC2)n1 |
| InChI | InChI=1S/C9H16N4S/c10-8-11-9(14-12-8)13-6-4-2-1-3-5-7-13/h1-7H2,(H2,10,12) |
| InChIKey | XILQKEHCDLBSSW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine?
The IUPAC name of 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine (CID 66280784) is 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine.
What is the SMILES notation for 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine?
The canonical SMILES for 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine is Nc1nsc(N2CCCCCCC2)n1.
What is the InChIKey of 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine?
The InChIKey is XILQKEHCDLBSSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S/c10-8-11-9(14-12-8)13-6-4-2-1-3-5-7-13/h1-7H2,(H2,10,12).
What are the key properties of 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine?
5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine has a molecular weight of 212.32 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azocan-1-yl)-1,2,4-thiadiazol-3-amine is sourced from PubChem (CID 66280784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).