C9H10F4N2O — CID 66280887
5-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine (PubChem CID 66280887) has the molecular formula C9H10F4N2O and a molecular weight of 238.18 g/mol. Its IUPAC name is 5-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine.
| Compound Name | 5-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 66280887 |
| Molecular Formula | C9H10F4N2O |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5-methyl-2-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine |
| SMILES | Cc1cnc(OCC(F)(F)C(F)F)c(N)c1 |
| InChI | InChI=1S/C9H10F4N2O/c1-5-2-6(14)7(15-3-5)16-4-9(12,13)8(10)11/h2-3,8H,4,14H2,1H3 |
| InChIKey | KWLGKDKAXLHXOG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|