About 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine
2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine (PubChem CID 66281077) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine |
| PubChem CID | 66281077 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine |
| SMILES | COCCN(C)CCNc1ncc(C)cc1N |
| InChI | InChI=1S/C12H22N4O/c1-10-8-11(13)12(15-9-10)14-4-5-16(2)6-7-17-3/h8-9H,4-7,13H2,1-3H3,(H,14,15) |
| InChIKey | AJBDXZGQUXKPIW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine?
The IUPAC name of 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine (CID 66281077) is 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine.
What is the SMILES notation for 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine?
The canonical SMILES for 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine is COCCN(C)CCNc1ncc(C)cc1N.
What is the InChIKey of 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine?
The InChIKey is AJBDXZGQUXKPIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-10-8-11(13)12(15-9-10)14-4-5-16(2)6-7-17-3/h8-9H,4-7,13H2,1-3H3,(H,14,15).
What are the key properties of 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine?
2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine has a molecular weight of 238.33 g/mol, XLogP of 0.96, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-5-methylpyridine-2,3-diamine is sourced from PubChem (CID 66281077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).