About 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol
1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 66281221) has the molecular formula C9H17N5OS
and a molecular weight of 243.34 g/mol. Its IUPAC name is 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| PubChem CID | 66281221 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1c1nc(N)ns1 |
| InChI | InChI=1S/C9H17N5OS/c1-13(2)4-6-3-7(15)5-14(6)9-11-8(10)12-16-9/h6-7,15H,3-5H2,1-2H3,(H2,10,12) |
| InChIKey | MUXKLARWMSCYIQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
The IUPAC name of 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol (CID 66281221) is 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
The canonical SMILES for 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol is CN(C)CC1CC(O)CN1c1nc(N)ns1.
What is the InChIKey of 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
The InChIKey is MUXKLARWMSCYIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5OS/c1-13(2)4-6-3-7(15)5-14(6)9-11-8(10)12-16-9/h6-7,15H,3-5H2,1-2H3,(H2,10,12).
What are the key properties of 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol has a molecular weight of 243.34 g/mol, XLogP of -0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-1,2,4-thiadiazol-5-yl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol is sourced from PubChem (CID 66281221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).