C6H7N5O2S — CID 66281222
4-(3-amino-1,2,4-thiadiazol-5-yl)piperazine-2,6-dione (PubChem CID 66281222) has the molecular formula C6H7N5O2S and a molecular weight of 213.22 g/mol. Its IUPAC name is 4-(3-amino-1,2,4-thiadiazol-5-yl)piperazine-2,6-dione.
| Compound Name | 4-(3-amino-1,2,4-thiadiazol-5-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66281222 |
| Molecular Formula | C6H7N5O2S |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 4-(3-amino-1,2,4-thiadiazol-5-yl)piperazine-2,6-dione |
| SMILES | Nc1nsc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C6H7N5O2S/c7-5-9-6(14-10-5)11-1-3(12)8-4(13)2-11/h1-2H2,(H2,7,10)(H,8,12,13) |
| InChIKey | SMTXKHZQQDIZAO-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|