C10H15N5O2 — CID 66281401
7-(2-ethoxyethylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66281401) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 7-(2-ethoxyethylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-(2-ethoxyethylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66281401 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 7-(2-ethoxyethylamino)-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | CCOCCNc1cc2n[nH]c(=O)n2c(C)n1 |
| InChI | InChI=1S/C10H15N5O2/c1-3-17-5-4-11-8-6-9-13-14-10(16)15(9)7(2)12-8/h6,11H,3-5H2,1-2H3,(H,14,16) |
| InChIKey | ABDDMUMRGYJBGE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|