C11H12N6O3 — CID 66281424
3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione (PubChem CID 66281424) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 66281424 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione |
| SMILES | Cc1nc(NC2CCC(=O)NC2=O)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C11H12N6O3/c1-5-12-7(4-8-15-16-11(20)17(5)8)13-6-2-3-9(18)14-10(6)19/h4,6,13H,2-3H2,1H3,(H,16,20)(H,14,18,19) |
| InChIKey | YEAWHKGCXWVBKU-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|