C12H14N6O3 — CID 66281425
1-methyl-3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione (PubChem CID 66281425) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-methyl-3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione.
| Compound Name | 1-methyl-3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 66281425 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-methyl-3-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]piperidine-2,6-dione |
| SMILES | Cc1nc(NC2CCC(=O)N(C)C2=O)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C12H14N6O3/c1-6-13-8(5-9-15-16-12(21)18(6)9)14-7-3-4-10(19)17(2)11(7)20/h5,7,14H,3-4H2,1-2H3,(H,16,21) |
| InChIKey | YVXHNTWOBWHAIA-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|