C9H13N5O2 — CID 66281454
6-(2-ethoxyethylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66281454) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 6-(2-ethoxyethylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(2-ethoxyethylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66281454 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 6-(2-ethoxyethylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCOCCNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C9H13N5O2/c1-2-16-6-5-10-7-3-4-8-11-12-9(15)14(8)13-7/h3-4H,2,5-6H2,1H3,(H,10,13)(H,12,15) |
| InChIKey | RBPFOSHXOZPJGM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|