C10H13N5O2 — CID 66281469
6-(oxan-3-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66281469) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 6-(oxan-3-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(oxan-3-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66281469 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 6-(oxan-3-ylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(NC3CCCOC3)nn12 |
| InChI | InChI=1S/C10H13N5O2/c16-10-13-12-9-4-3-8(14-15(9)10)11-7-2-1-5-17-6-7/h3-4,7H,1-2,5-6H2,(H,11,14)(H,13,16) |
| InChIKey | SSHZUAQQPQIGQA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |