C12H19N7O — CID 66281478
6-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66281478) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is 6-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66281478 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 6-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(NCCCN3CCNCC3)nn12 |
| InChI | InChI=1S/C12H19N7O/c20-12-16-15-11-3-2-10(17-19(11)12)14-4-1-7-18-8-5-13-6-9-18/h2-3,13H,1,4-9H2,(H,14,17)(H,16,20) |
| InChIKey | LBTJQIZLOBKCOP-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|