C10H13ClN4O — CID 66281503
6-(2-chloropentyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66281503) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is 6-(2-chloropentyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(2-chloropentyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66281503 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 6-(2-chloropentyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCCC(Cl)Cc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C10H13ClN4O/c1-2-3-7(11)6-8-4-5-9-12-13-10(16)15(9)14-8/h4-5,7H,2-3,6H2,1H3,(H,13,16) |
| InChIKey | HSBPRNMBNNJUBG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|