C10H15N5O2 — CID 66281690
6-[2-(propylamino)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66281690) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-[2-(propylamino)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-[2-(propylamino)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66281690 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-[2-(propylamino)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCCNCCOc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C10H15N5O2/c1-2-5-11-6-7-17-9-4-3-8-12-13-10(16)15(8)14-9/h3-4,11H,2,5-7H2,1H3,(H,13,16) |
| InChIKey | QLDYDTADQMTMRE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|