C10H14N6O2 — CID 66281993
4-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]butanamide (PubChem CID 66281993) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]butanamide.
| Compound Name | 4-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]butanamide |
|---|---|
| PubChem CID | 66281993 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-[(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]butanamide |
| SMILES | Cc1nc(NCCCC(N)=O)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C10H14N6O2/c1-6-13-8(12-4-2-3-7(11)17)5-9-14-15-10(18)16(6)9/h5,12H,2-4H2,1H3,(H2,11,17)(H,15,18) |
| InChIKey | MTWPDTLYSUFQTF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|