C11H16N6OS — CID 66282951
3-[ethyl-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]propanethioamide (PubChem CID 66282951) has the molecular formula C11H16N6OS and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-[ethyl-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]propanethioamide.
| Compound Name | 3-[ethyl-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]propanethioamide |
|---|---|
| PubChem CID | 66282951 |
| Molecular Formula | C11H16N6OS |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[ethyl-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)amino]propanethioamide |
| SMILES | CCN(CCC(N)=S)c1cc2n[nH]c(=O)n2c(C)n1 |
| InChI | InChI=1S/C11H16N6OS/c1-3-16(5-4-8(12)19)9-6-10-14-15-11(18)17(10)7(2)13-9/h6H,3-5H2,1-2H3,(H2,12,19)(H,15,18) |
| InChIKey | JBBVQJPCWHBMJP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|