C10H12ClN5O — CID 66283134
7-[2-chloroethyl(cyclopropyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66283134) has the molecular formula C10H12ClN5O and a molecular weight of 253.69 g/mol. Its IUPAC name is 7-[2-chloroethyl(cyclopropyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[2-chloroethyl(cyclopropyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66283134 |
| Molecular Formula | C10H12ClN5O |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 7-[2-chloroethyl(cyclopropyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | O=c1[nH]nc2cc(N(CCCl)C3CC3)ncn12 |
| InChI | InChI=1S/C10H12ClN5O/c11-3-4-15(7-1-2-7)8-5-9-13-14-10(17)16(9)6-12-8/h5-7H,1-4H2,(H,14,17) |
| InChIKey | FSGDLQGHSOFFIG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|