C9H14N6O2 — CID 66283139
7-[2-(2-aminoethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66283139) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 7-[2-(2-aminoethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[2-(2-aminoethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66283139 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 7-[2-(2-aminoethoxy)ethylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | NCCOCCNc1cc2n[nH]c(=O)n2cn1 |
| InChI | InChI=1S/C9H14N6O2/c10-1-3-17-4-2-11-7-5-8-13-14-9(16)15(8)6-12-7/h5-6,11H,1-4,10H2,(H,14,16) |
| InChIKey | LQQNRKVTXIKGMU-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|