C11H17N7O — CID 66283592
3-[ethyl-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2-methylpropanimidamide (PubChem CID 66283592) has the molecular formula C11H17N7O and a molecular weight of 263.31 g/mol. Its IUPAC name is 3-[ethyl-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2-methylpropanimidamide.
| Compound Name | 3-[ethyl-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 66283592 |
| Molecular Formula | C11H17N7O |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[ethyl-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN(CC)c1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C11H17N7O/c1-3-17(6-7(2)10(12)13)9-5-4-8-14-15-11(19)18(8)16-9/h4-5,7H,3,6H2,1-2H3,(H3,12,13)(H,15,19) |
| InChIKey | UTCFYIDWTMWNDO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|