C14H16N6O — CID 66283775
7-[1-(4-aminophenyl)ethylamino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66283775) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 7-[1-(4-aminophenyl)ethylamino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[1-(4-aminophenyl)ethylamino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66283775 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 7-[1-(4-aminophenyl)ethylamino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(NC(C)c2ccc(N)cc2)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C14H16N6O/c1-8(10-3-5-11(15)6-4-10)16-12-7-13-18-19-14(21)20(13)9(2)17-12/h3-8,16H,15H2,1-2H3,(H,19,21) |
| InChIKey | KQJHXGLFMMZYNK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|