C8H9ClN4O3S — CID 66284015
6-(3-chloropropylsulfonyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 66284015) has the molecular formula C8H9ClN4O3S and a molecular weight of 276.70 g/mol. Its IUPAC name is 6-(3-chloropropylsulfonyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(3-chloropropylsulfonyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 66284015 |
| Molecular Formula | C8H9ClN4O3S |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 6-(3-chloropropylsulfonyl)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(S(=O)(=O)CCCCl)nn12 |
| InChI | InChI=1S/C8H9ClN4O3S/c9-4-1-5-17(15,16)7-3-2-6-10-11-8(14)13(6)12-7/h2-3H,1,4-5H2,(H,11,14) |
| InChIKey | FMLGNAZYPPRVDE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|