C11H15N7O — CID 66284380
1-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboximidamide (PubChem CID 66284380) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboximidamide.
| Compound Name | 1-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 66284380 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCN(c2ccc3n[nH]c(=O)n3n2)CC1 |
| InChI | InChI=1S/C11H15N7O/c12-10(13)7-3-5-17(6-4-7)9-2-1-8-14-15-11(19)18(8)16-9/h1-2,7H,3-6H2,(H3,12,13)(H,15,19) |
| InChIKey | VQPKTGPICQVDKQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|