C14H8Cl2N4S2 — CID 662849
3-(2,4-dichlorophenyl)-6-(thiophen-2-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 662849) has the molecular formula C14H8Cl2N4S2 and a molecular weight of 367.29 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-(thiophen-2-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(2,4-dichlorophenyl)-6-(thiophen-2-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 662849 |
| Molecular Formula | C14H8Cl2N4S2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-(thiophen-2-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(-c2nnc3sc(Cc4cccs4)nn23)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N4S2/c15-8-3-4-10(11(16)6-8)13-17-18-14-20(13)19-12(22-14)7-9-2-1-5-21-9/h1-6H,7H2 |
| InChIKey | JUJRKVXYFVAWMB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |