About methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate
methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate (PubChem CID 66285127) has the molecular formula C11H13N5O2
and a molecular weight of 247.26 g/mol. Its IUPAC name is methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate |
| PubChem CID | 66285127 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(-n2nc(C)c(N)c2C)n1 |
| InChI | InChI=1S/C11H13N5O2/c1-6-9(12)7(2)16(15-6)8-4-5-13-10(14-8)11(17)18-3/h4-5H,12H2,1-3H3 |
| InChIKey | RNMQHSJBSYRSDK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate?
The IUPAC name of methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate (CID 66285127) is methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate?
The canonical SMILES for methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate is COC(=O)c1nccc(-n2nc(C)c(N)c2C)n1.
What is the InChIKey of methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate?
The InChIKey is RNMQHSJBSYRSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O2/c1-6-9(12)7(2)16(15-6)8-4-5-13-10(14-8)11(17)18-3/h4-5H,12H2,1-3H3.
What are the key properties of methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate?
methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate has a molecular weight of 247.26 g/mol, XLogP of 0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-amino-3,5-dimethylpyrazol-1-yl)pyrimidine-2-carboxylate is sourced from PubChem (CID 66285127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).