C11H14F3N3O3 — CID 66285267
methyl 4-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-2-carboxylate (PubChem CID 66285267) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is methyl 4-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66285267 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | methyl 4-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H14F3N3O3/c1-7-5-8(17-9(16-7)10(18)19-2)15-3-4-20-6-11(12,13)14/h5H,3-4,6H2,1-2H3,(H,15,16,17) |
| InChIKey | LTKUPJCEBYBFKH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|