About 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one
4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (PubChem CID 66285575) has the molecular formula C6H4F3IN2O2
and a molecular weight of 320.01 g/mol. Its IUPAC name is 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| PubChem CID | 66285575 |
| Molecular Formula | C6H4F3IN2O2 |
| Molecular Weight | 320.01 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc(O)c1I |
| InChI | InChI=1S/C6H4F3IN2O2/c7-6(8,9)1-2-11-4(13)3(10)5(14)12-2/h1H2,(H2,11,12,13,14) |
| InChIKey | NSCVLOTYZXVJPQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.01 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
The IUPAC name of 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (CID 66285575) is 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one is O=c1[nH]c(CC(F)(F)F)nc(O)c1I.
What is the InChIKey of 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
The InChIKey is NSCVLOTYZXVJPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3IN2O2/c7-6(8,9)1-2-11-4(13)3(10)5(14)12-2/h1H2,(H2,11,12,13,14).
What are the key properties of 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one has a molecular weight of 320.01 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-iodo-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 66285575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).