About methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate
methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate (PubChem CID 66285823) has the molecular formula C8H8F3N3O2
and a molecular weight of 235.16 g/mol. Its IUPAC name is methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate |
| PubChem CID | 66285823 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(NCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F3N3O2/c1-16-7(15)6-12-3-2-5(14-6)13-4-8(9,10)11/h2-3H,4H2,1H3,(H,12,13,14) |
| InChIKey | WZWXQSLLWRJLHO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate?
The IUPAC name of methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate (CID 66285823) is methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate?
The canonical SMILES for methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate is COC(=O)c1nccc(NCC(F)(F)F)n1.
What is the InChIKey of methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate?
The InChIKey is WZWXQSLLWRJLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O2/c1-16-7(15)6-12-3-2-5(14-6)13-4-8(9,10)11/h2-3H,4H2,1H3,(H,12,13,14).
What are the key properties of methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate?
methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate has a molecular weight of 235.16 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2,2-trifluoroethylamino)pyrimidine-2-carboxylate is sourced from PubChem (CID 66285823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).