C14H21N3O2 — CID 66285860
methyl 4-[(1-methylpiperidin-2-yl)methylamino]pyridine-2-carboxylate (PubChem CID 66285860) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl 4-[(1-methylpiperidin-2-yl)methylamino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[(1-methylpiperidin-2-yl)methylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 66285860 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | methyl 4-[(1-methylpiperidin-2-yl)methylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NCC2CCCCN2C)ccn1 |
| InChI | InChI=1S/C14H21N3O2/c1-17-8-4-3-5-12(17)10-16-11-6-7-15-13(9-11)14(18)19-2/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,15,16) |
| InChIKey | YDXGVIQCBFWJEC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |