About methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate
methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate (PubChem CID 66286676) has the molecular formula C10H12F3N3O2
and a molecular weight of 263.22 g/mol. Its IUPAC name is methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate |
| PubChem CID | 66286676 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(NCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N3O2/c1-6-5-7(14-4-3-10(11,12)13)16-8(15-6)9(17)18-2/h5H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | KFNSHVMHURSISI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate?
The IUPAC name of methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate (CID 66286676) is methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate?
The canonical SMILES for methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate is COC(=O)c1nc(C)cc(NCCC(F)(F)F)n1.
What is the InChIKey of methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate?
The InChIKey is KFNSHVMHURSISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3N3O2/c1-6-5-7(14-4-3-10(11,12)13)16-8(15-6)9(17)18-2/h5H,3-4H2,1-2H3,(H,14,15,16).
What are the key properties of methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate?
methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate has a molecular weight of 263.22 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-6-(3,3,3-trifluoropropylamino)pyrimidine-2-carboxylate is sourced from PubChem (CID 66286676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).