About 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one
5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (PubChem CID 66286759) has the molecular formula C6H4BrF3N2O2
and a molecular weight of 273.01 g/mol. Its IUPAC name is 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| PubChem CID | 66286759 |
| Molecular Formula | C6H4BrF3N2O2 |
| Molecular Weight | 273.01 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc(O)c1Br |
| InChI | InChI=1S/C6H4BrF3N2O2/c7-3-4(13)11-2(12-5(3)14)1-6(8,9)10/h1H2,(H2,11,12,13,14) |
| InChIKey | ZLBJMYQQOZXMHG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.01 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (CID 66286759) is 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one is O=c1[nH]c(CC(F)(F)F)nc(O)c1Br.
What is the InChIKey of 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
The InChIKey is ZLBJMYQQOZXMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF3N2O2/c7-3-4(13)11-2(12-5(3)14)1-6(8,9)10/h1H2,(H2,11,12,13,14).
What are the key properties of 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one?
5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one has a molecular weight of 273.01 g/mol, XLogP of 1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-hydroxy-2-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 66286759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).