C18H18N6S — CID 662880
N,N-diethyl-4-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (PubChem CID 662880) has the molecular formula C18H18N6S and a molecular weight of 350.45 g/mol. Its IUPAC name is N,N-diethyl-4-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline.
| Compound Name | N,N-diethyl-4-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
|---|---|
| PubChem CID | 662880 |
| Molecular Formula | C18H18N6S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N,N-diethyl-4-(3-pyridin-3-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| SMILES | CCN(CC)c1ccc(-c2nn3c(-c4cccnc4)nnc3s2)cc1 |
| InChI | InChI=1S/C18H18N6S/c1-3-23(4-2)15-9-7-13(8-10-15)17-22-24-16(20-21-18(24)25-17)14-6-5-11-19-12-14/h5-12H,3-4H2,1-2H3 |
| InChIKey | OSWNMRLFEDXYOC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |