C12H17N5O4 — CID 66289328
1-[2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66289328) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-[2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66289328 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-[2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CN(CC(=O)N1CCCC1)C(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C12H17N5O4/c1-15(7-11(19)16-4-2-3-5-16)10(18)8-17-6-9(12(20)21)13-14-17/h6H,2-5,7-8H2,1H3,(H,20,21) |
| InChIKey | PVLDGABMLDNRKN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |