C10H14N4O4 — CID 66289573
2-[4-(4-hydroxypiperidine-1-carbonyl)triazol-1-yl]acetic acid (PubChem CID 66289573) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[4-(4-hydroxypiperidine-1-carbonyl)triazol-1-yl]acetic acid.
| Compound Name | 2-[4-(4-hydroxypiperidine-1-carbonyl)triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 66289573 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-[4-(4-hydroxypiperidine-1-carbonyl)triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)N2CCC(O)CC2)nn1 |
| InChI | InChI=1S/C10H14N4O4/c15-7-1-3-13(4-2-7)10(18)8-5-14(12-11-8)6-9(16)17/h5,7,15H,1-4,6H2,(H,16,17) |
| InChIKey | VEFKNEMWAMQLBY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |