C11H9ClN4O3 — CID 66290398
2-[4-[(2-chlorophenyl)carbamoyl]triazol-1-yl]acetic acid (PubChem CID 66290398) has the molecular formula C11H9ClN4O3 and a molecular weight of 280.67 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)carbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(2-chlorophenyl)carbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 66290398 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)carbamoyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)Nc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C11H9ClN4O3/c12-7-3-1-2-4-8(7)13-11(19)9-5-16(15-14-9)6-10(17)18/h1-5H,6H2,(H,13,19)(H,17,18) |
| InChIKey | FNRPPMWUFPUETO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |