About 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine
5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine (PubChem CID 66292401) has the molecular formula C14H12BrClF2N2
and a molecular weight of 361.62 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine |
| PubChem CID | 66292401 |
| Molecular Formula | C14H12BrClF2N2 |
| Molecular Weight | 361.62 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine |
| SMILES | CC(C)c1nc(Cc2cc(F)cc(F)c2)nc(Cl)c1Br |
| InChI | InChI=1S/C14H12BrClF2N2/c1-7(2)13-12(15)14(16)20-11(19-13)5-8-3-9(17)6-10(18)4-8/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | VFDRBZXCPAAJQN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine?
The IUPAC name of 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine (CID 66292401) is 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine.
What is the SMILES notation for 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine?
The canonical SMILES for 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine is CC(C)c1nc(Cc2cc(F)cc(F)c2)nc(Cl)c1Br.
What is the InChIKey of 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine?
The InChIKey is VFDRBZXCPAAJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrClF2N2/c1-7(2)13-12(15)14(16)20-11(19-13)5-8-3-9(17)6-10(18)4-8/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine?
5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine has a molecular weight of 361.62 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-2-[(3,5-difluorophenyl)methyl]-6-propan-2-ylpyrimidine is sourced from PubChem (CID 66292401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).