About 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine
5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine (PubChem CID 66292667) has the molecular formula C11H12BrClN2O2
and a molecular weight of 319.59 g/mol. Its IUPAC name is 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine |
| PubChem CID | 66292667 |
| Molecular Formula | C11H12BrClN2O2 |
| Molecular Weight | 319.59 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine |
| SMILES | Clc1nc(C2COCCO2)nc(C2CC2)c1Br |
| InChI | InChI=1S/C11H12BrClN2O2/c12-8-9(6-1-2-6)14-11(15-10(8)13)7-5-16-3-4-17-7/h6-7H,1-5H2 |
| InChIKey | MASUFVSMPHWTJW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine?
The IUPAC name of 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine (CID 66292667) is 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine.
What is the SMILES notation for 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine?
The canonical SMILES for 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine is Clc1nc(C2COCCO2)nc(C2CC2)c1Br.
What is the InChIKey of 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine?
The InChIKey is MASUFVSMPHWTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrClN2O2/c12-8-9(6-1-2-6)14-11(15-10(8)13)7-5-16-3-4-17-7/h6-7H,1-5H2.
What are the key properties of 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine?
5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine has a molecular weight of 319.59 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-6-cyclopropyl-2-(1,4-dioxan-2-yl)pyrimidine is sourced from PubChem (CID 66292667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).