About 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine
5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine (PubChem CID 66294671) has the molecular formula C15H16BrClN2O
and a molecular weight of 355.66 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine |
| PubChem CID | 66294671 |
| Molecular Formula | C15H16BrClN2O |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine |
| SMILES | COCc1nc(Cc2cc(C)cc(C)c2)nc(Cl)c1Br |
| InChI | InChI=1S/C15H16BrClN2O/c1-9-4-10(2)6-11(5-9)7-13-18-12(8-20-3)14(16)15(17)19-13/h4-6H,7-8H2,1-3H3 |
| InChIKey | RGPRBXSMOTWIEK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine?
The IUPAC name of 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine (CID 66294671) is 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine.
What is the SMILES notation for 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine?
The canonical SMILES for 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine is COCc1nc(Cc2cc(C)cc(C)c2)nc(Cl)c1Br.
What is the InChIKey of 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine?
The InChIKey is RGPRBXSMOTWIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrClN2O/c1-9-4-10(2)6-11(5-9)7-13-18-12(8-20-3)14(16)15(17)19-13/h4-6H,7-8H2,1-3H3.
What are the key properties of 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine?
5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine has a molecular weight of 355.66 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-2-[(3,5-dimethylphenyl)methyl]-6-(methoxymethyl)pyrimidine is sourced from PubChem (CID 66294671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).