C14H20IN5O — CID 66295855
N-ethyl-5-iodo-6-(methoxymethyl)-2-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine (PubChem CID 66295855) has the molecular formula C14H20IN5O and a molecular weight of 401.25 g/mol. Its IUPAC name is N-ethyl-5-iodo-6-(methoxymethyl)-2-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-6-(methoxymethyl)-2-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66295855 |
| Molecular Formula | C14H20IN5O |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-ethyl-5-iodo-6-(methoxymethyl)-2-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2c(C)nn(C)c2C)nc(COC)c1I |
| InChI | InChI=1S/C14H20IN5O/c1-6-16-14-12(15)10(7-21-5)17-13(18-14)11-8(2)19-20(4)9(11)3/h6-7H2,1-5H3,(H,16,17,18) |
| InChIKey | YSRCXSODBFNQTG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|