About 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine
5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine (PubChem CID 66298665) has the molecular formula C11H18BrN3S
and a molecular weight of 304.26 g/mol. Its IUPAC name is 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine |
| PubChem CID | 66298665 |
| Molecular Formula | C11H18BrN3S |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(CSCC)nc(CC)c1Br |
| InChI | InChI=1S/C11H18BrN3S/c1-4-8-10(12)11(13-5-2)15-9(14-8)7-16-6-3/h4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | OSAHATVCRVHMTC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine?
The IUPAC name of 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine (CID 66298665) is 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine?
The canonical SMILES for 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine is CCNc1nc(CSCC)nc(CC)c1Br.
What is the InChIKey of 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine?
The InChIKey is OSAHATVCRVHMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrN3S/c1-4-8-10(12)11(13-5-2)15-9(14-8)7-16-6-3/h4-7H2,1-3H3,(H,13,14,15).
What are the key properties of 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine?
5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine has a molecular weight of 304.26 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,6-diethyl-2-(ethylsulfanylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 66298665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).