C15H17BrClN3S — CID 66299315
5-bromo-2-[(3-chlorophenyl)sulfanylmethyl]-N-methyl-6-propan-2-ylpyrimidin-4-amine (PubChem CID 66299315) has the molecular formula C15H17BrClN3S and a molecular weight of 386.75 g/mol. Its IUPAC name is 5-bromo-2-[(3-chlorophenyl)sulfanylmethyl]-N-methyl-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-[(3-chlorophenyl)sulfanylmethyl]-N-methyl-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299315 |
| Molecular Formula | C15H17BrClN3S |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 5-bromo-2-[(3-chlorophenyl)sulfanylmethyl]-N-methyl-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CNc1nc(CSc2cccc(Cl)c2)nc(C(C)C)c1Br |
| InChI | InChI=1S/C15H17BrClN3S/c1-9(2)14-13(16)15(18-3)20-12(19-14)8-21-11-6-4-5-10(17)7-11/h4-7,9H,8H2,1-3H3,(H,18,19,20) |
| InChIKey | FFDLXTHUABXWLA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |